C12H22N2 — CID 143431654
ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine (PubChem CID 143431654) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine.
| Compound Name | ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine |
|---|---|
| PubChem CID | 143431654 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine |
| SMILES | C=CC1=C(/N=C/C)CCN(C)C1.CC |
| InChI | InChI=1S/C10H16N2.C2H6/c1-4-9-8-12(3)7-6-10(9)11-5-2;1-2/h4-5H,1,6-8H2,2-3H3;1-2H3/b11-5+; |
| InChIKey | LJSQEBMIFQSLCD-HMXKFKBXSA-N |
| XLogP | 2.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|