C10H18N2 — CID 142957123
(3Z)-N,N,4-trimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine (PubChem CID 142957123) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3Z)-N,N,4-trimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine.
| Compound Name | (3Z)-N,N,4-trimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142957123 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3Z)-N,N,4-trimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine |
| SMILES | C=C/C(C)=C(/CCN(C)C)N=C |
| InChI | InChI=1S/C10H18N2/c1-6-9(2)10(11-3)7-8-12(4)5/h6H,1,3,7-8H2,2,4-5H3/b10-9- |
| InChIKey | TXIYWDZRBJMJPR-KTKRTIGZSA-N |
| XLogP | 2.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|