C9H13IN2 — CID 126687783
N-[1-iodo-5-[(Z)-prop-1-enyl]-3,6-dihydro-2H-pyridin-4-yl]methanimine (PubChem CID 126687783) has the molecular formula C9H13IN2 and a molecular weight of 276.12 g/mol. Its IUPAC name is N-[1-iodo-5-[(Z)-prop-1-enyl]-3,6-dihydro-2H-pyridin-4-yl]methanimine.
| Compound Name | N-[1-iodo-5-[(Z)-prop-1-enyl]-3,6-dihydro-2H-pyridin-4-yl]methanimine |
|---|---|
| PubChem CID | 126687783 |
| Molecular Formula | C9H13IN2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | N-[1-iodo-5-[(Z)-prop-1-enyl]-3,6-dihydro-2H-pyridin-4-yl]methanimine |
| SMILES | C=NC1=C(/C=C\C)CN(I)CC1 |
| InChI | InChI=1S/C9H13IN2/c1-3-4-8-7-12(10)6-5-9(8)11-2/h3-4H,2,5-7H2,1H3/b4-3- |
| InChIKey | CZOCJUITKZWPTF-ARJAWSKDSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|