C11H20N2 — CID 143785621
ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanimine (PubChem CID 143785621) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanimine.
| Compound Name | ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanimine |
|---|---|
| PubChem CID | 143785621 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;N-(5-ethenyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanimine |
| SMILES | C=CC1=C(N=C)CCN(C)C1.CC |
| InChI | InChI=1S/C9H14N2.C2H6/c1-4-8-7-11(3)6-5-9(8)10-2;1-2/h4H,1-2,5-7H2,3H3;1-2H3 |
| InChIKey | JBLXXOMRQNOPDU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|