C13H20N2 — CID 142827481
N-ethyl-N,5,5-trimethyl-2-(methylideneamino)cyclohepta-1,3,6-trien-1-amine (PubChem CID 142827481) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-ethyl-N,5,5-trimethyl-2-(methylideneamino)cyclohepta-1,3,6-trien-1-amine.
| Compound Name | N-ethyl-N,5,5-trimethyl-2-(methylideneamino)cyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 142827481 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-ethyl-N,5,5-trimethyl-2-(methylideneamino)cyclohepta-1,3,6-trien-1-amine |
| SMILES | C=NC1=C(N(C)CC)C=CC(C)(C)C=C1 |
| InChI | InChI=1S/C13H20N2/c1-6-15(5)12-8-10-13(2,3)9-7-11(12)14-4/h7-10H,4,6H2,1-3,5H3 |
| InChIKey | PLGVBHGJWHANCX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|