C11H22N2 — CID 143687581
(3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine;ethane (PubChem CID 143687581) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine;ethane.
| Compound Name | (3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine;ethane |
|---|---|
| PubChem CID | 143687581 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine;ethane |
| SMILES | C=C/C=C(/CCN(C)C)N=C.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-5-6-9(10-2)7-8-11(3)4;1-2/h5-6H,1-2,7-8H2,3-4H3;1-2H3/b9-6-; |
| InChIKey | UHEWWXGCKWLRPK-BORNJIKYSA-N |
| XLogP | 2.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|