C16H25N2+ — CID 123998959
methylidene-(2-methylprop-2-enyl)-[4-(pent-3-enylideneamino)hexa-1,4-dien-2-yl]azanium (PubChem CID 123998959) has the molecular formula C16H25N2+ and a molecular weight of 245.39 g/mol. Its IUPAC name is methylidene-(2-methylprop-2-enyl)-[4-(pent-3-enylideneamino)hexa-1,4-dien-2-yl]azanium.
| Compound Name | methylidene-(2-methylprop-2-enyl)-[4-(pent-3-enylideneamino)hexa-1,4-dien-2-yl]azanium |
|---|---|
| PubChem CID | 123998959 |
| Molecular Formula | C16H25N2+ |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | methylidene-(2-methylprop-2-enyl)-[4-(pent-3-enylideneamino)hexa-1,4-dien-2-yl]azanium |
| SMILES | C=C(C)C[N+](=C)C(=C)CC(=CC)/N=C/CC=CC |
| InChI | InChI=1S/C16H25N2/c1-7-9-10-11-17-16(8-2)12-15(5)18(6)13-14(3)4/h7-9,11H,3,5-6,10,12-13H2,1-2,4H3/q+1/b9-7?,16-8?,17-11+ |
| InChIKey | SCNKOEZOMNZQAY-LXNAVYMMSA-N |
| XLogP | 4.12 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|