C22H20N2O2 — CID 123496661
4-[3-(N-methylanilino)oxiran-2-yl]-N-phenylbenzamide (PubChem CID 123496661) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[3-(N-methylanilino)oxiran-2-yl]-N-phenylbenzamide.
| Compound Name | 4-[3-(N-methylanilino)oxiran-2-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 123496661 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[3-(N-methylanilino)oxiran-2-yl]-N-phenylbenzamide |
| SMILES | CN(c1ccccc1)C1OC1c1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O2/c1-24(19-10-6-3-7-11-19)22-20(26-22)16-12-14-17(15-13-16)21(25)23-18-8-4-2-5-9-18/h2-15,20,22H,1H3,(H,23,25) |
| InChIKey | NDLWSJYDPFKPGO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|