C11H20N2O — CID 123497095
1-(2-penta-1,3-dien-2-yloxyethyl)piperazine (PubChem CID 123497095) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(2-penta-1,3-dien-2-yloxyethyl)piperazine.
| Compound Name | 1-(2-penta-1,3-dien-2-yloxyethyl)piperazine |
|---|---|
| PubChem CID | 123497095 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(2-penta-1,3-dien-2-yloxyethyl)piperazine |
| SMILES | C=C(C=CC)OCCN1CCNCC1 |
| InChI | InChI=1S/C11H20N2O/c1-3-4-11(2)14-10-9-13-7-5-12-6-8-13/h3-4,12H,2,5-10H2,1H3 |
| InChIKey | ZPBOOOAHZBKVJV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|