C14H26N2O — CID 123147935
1-(2-octa-4,6-dien-3-yloxyethyl)piperazine (PubChem CID 123147935) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-(2-octa-4,6-dien-3-yloxyethyl)piperazine.
| Compound Name | 1-(2-octa-4,6-dien-3-yloxyethyl)piperazine |
|---|---|
| PubChem CID | 123147935 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-(2-octa-4,6-dien-3-yloxyethyl)piperazine |
| SMILES | CC=CC=CC(CC)OCCN1CCNCC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-5-6-7-14(4-2)17-13-12-16-10-8-15-9-11-16/h3,5-7,14-15H,4,8-13H2,1-2H3 |
| InChIKey | RXKIWIZRALXIMX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|