C11H17NO — CID 123662227
2-hexa-1,3,5-trien-3-yl-6-methylmorpholine (PubChem CID 123662227) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-hexa-1,3,5-trien-3-yl-6-methylmorpholine.
| Compound Name | 2-hexa-1,3,5-trien-3-yl-6-methylmorpholine |
|---|---|
| PubChem CID | 123662227 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-hexa-1,3,5-trien-3-yl-6-methylmorpholine |
| SMILES | C=CC=C(C=C)C1CNCC(C)O1 |
| InChI | InChI=1S/C11H17NO/c1-4-6-10(5-2)11-8-12-7-9(3)13-11/h4-6,9,11-12H,1-2,7-8H2,3H3 |
| InChIKey | OOPRRUKXIHWCAI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|