C13H24N2O3 — CID 142884056
N'-[2-[2-(4-methoxycyclohexa-2,4-dien-1-yl)oxyethoxy]ethyl]ethane-1,2-diamine (PubChem CID 142884056) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is N'-[2-[2-(4-methoxycyclohexa-2,4-dien-1-yl)oxyethoxy]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-(4-methoxycyclohexa-2,4-dien-1-yl)oxyethoxy]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 142884056 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N'-[2-[2-(4-methoxycyclohexa-2,4-dien-1-yl)oxyethoxy]ethyl]ethane-1,2-diamine |
| SMILES | COC1=CCC(OCCOCCNCCN)C=C1 |
| InChI | InChI=1S/C13H24N2O3/c1-16-12-2-4-13(5-3-12)18-11-10-17-9-8-15-7-6-14/h2-4,13,15H,5-11,14H2,1H3 |
| InChIKey | PZPONLCEKOLMQW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|