C15H29N3O2 — CID 163436105
N-[2-(3-amino-6-methoxycyclohexa-1,3-dien-1-yl)oxyethyl]-N'-methyl-N'-propylethane-1,2-diamine (PubChem CID 163436105) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[2-(3-amino-6-methoxycyclohexa-1,3-dien-1-yl)oxyethyl]-N'-methyl-N'-propylethane-1,2-diamine.
| Compound Name | N-[2-(3-amino-6-methoxycyclohexa-1,3-dien-1-yl)oxyethyl]-N'-methyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 163436105 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-[2-(3-amino-6-methoxycyclohexa-1,3-dien-1-yl)oxyethyl]-N'-methyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(C)CCNCCOC1=CC(N)=CCC1OC |
| InChI | InChI=1S/C15H29N3O2/c1-4-9-18(2)10-7-17-8-11-20-15-12-13(16)5-6-14(15)19-3/h5,12,14,17H,4,6-11,16H2,1-3H3 |
| InChIKey | AUPSCCXQDCPXBT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|