C14H26N2O — CID 143281075
1-[(2E,4E)-3-propan-2-yloxyhepta-2,4-dien-4-yl]piperazine (PubChem CID 143281075) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-[(2E,4E)-3-propan-2-yloxyhepta-2,4-dien-4-yl]piperazine.
| Compound Name | 1-[(2E,4E)-3-propan-2-yloxyhepta-2,4-dien-4-yl]piperazine |
|---|---|
| PubChem CID | 143281075 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-[(2E,4E)-3-propan-2-yloxyhepta-2,4-dien-4-yl]piperazine |
| SMILES | C/C=C(OC(C)C)\C(=C/CC)N1CCNCC1 |
| InChI | InChI=1S/C14H26N2O/c1-5-7-13(14(6-2)17-12(3)4)16-10-8-15-9-11-16/h6-7,12,15H,5,8-11H2,1-4H3/b13-7+,14-6+ |
| InChIKey | ZXFKKUNRWQANNV-CAZMDNNUSA-N |
| XLogP | 2.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|