C13H22N2O — CID 142202931
1-[(2E,5E)-6-methoxyocta-2,5,7-trien-2-yl]piperazine (PubChem CID 142202931) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[(2E,5E)-6-methoxyocta-2,5,7-trien-2-yl]piperazine.
| Compound Name | 1-[(2E,5E)-6-methoxyocta-2,5,7-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 142202931 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-[(2E,5E)-6-methoxyocta-2,5,7-trien-2-yl]piperazine |
| SMILES | C=C/C(=C\C/C=C(\C)N1CCNCC1)OC |
| InChI | InChI=1S/C13H22N2O/c1-4-13(16-3)7-5-6-12(2)15-10-8-14-9-11-15/h4,6-7,14H,1,5,8-11H2,2-3H3/b12-6+,13-7+ |
| InChIKey | PGLUKXGEMVXAGR-PWHKKFIBSA-N |
| XLogP | 1.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|