C12H18N2O — CID 142202921
1-(4-methoxycyclohepta-1,3,6-trien-1-yl)piperazine (PubChem CID 142202921) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(4-methoxycyclohepta-1,3,6-trien-1-yl)piperazine.
| Compound Name | 1-(4-methoxycyclohepta-1,3,6-trien-1-yl)piperazine |
|---|---|
| PubChem CID | 142202921 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(4-methoxycyclohepta-1,3,6-trien-1-yl)piperazine |
| SMILES | COC1=CC=C(N2CCNCC2)C=CC1 |
| InChI | InChI=1S/C12H18N2O/c1-15-12-4-2-3-11(5-6-12)14-9-7-13-8-10-14/h2-3,5-6,13H,4,7-10H2,1H3 |
| InChIKey | GATKFEVYOOKUST-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |