C13H24N2O — CID 142202949
1-[(3Z,6E)-6-methoxyocta-3,6-dienyl]piperazine (PubChem CID 142202949) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[(3Z,6E)-6-methoxyocta-3,6-dienyl]piperazine.
| Compound Name | 1-[(3Z,6E)-6-methoxyocta-3,6-dienyl]piperazine |
|---|---|
| PubChem CID | 142202949 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-[(3Z,6E)-6-methoxyocta-3,6-dienyl]piperazine |
| SMILES | C/C=C(\C/C=C\CCN1CCNCC1)OC |
| InChI | InChI=1S/C13H24N2O/c1-3-13(16-2)7-5-4-6-10-15-11-8-14-9-12-15/h3-5,14H,6-12H2,1-2H3/b5-4-,13-3+ |
| InChIKey | GWEXIHWMDOYGRM-BNXXKACXSA-N |
| XLogP | 1.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|