C14H24N2O — CID 142202958
1-[(3Z,5E)-5-methoxy-2-methylocta-3,5,7-trienyl]piperazine (PubChem CID 142202958) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[(3Z,5E)-5-methoxy-2-methylocta-3,5,7-trienyl]piperazine.
| Compound Name | 1-[(3Z,5E)-5-methoxy-2-methylocta-3,5,7-trienyl]piperazine |
|---|---|
| PubChem CID | 142202958 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-[(3Z,5E)-5-methoxy-2-methylocta-3,5,7-trienyl]piperazine |
| SMILES | C=C/C=C(\C=C/C(C)CN1CCNCC1)OC |
| InChI | InChI=1S/C14H24N2O/c1-4-5-14(17-3)7-6-13(2)12-16-10-8-15-9-11-16/h4-7,13,15H,1,8-12H2,2-3H3/b7-6-,14-5+ |
| InChIKey | LKTIMUQSOVFSBU-WFRORPSUSA-N |
| XLogP | 1.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|