About 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine
1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine (PubChem CID 142202943) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine.
Molecular Properties
| Compound Name | 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine |
| PubChem CID | 142202943 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine |
| SMILES | C=C/C=C(/OC)C(C)N1CCNCC1 |
| InChI | InChI=1S/C11H20N2O/c1-4-5-11(14-3)10(2)13-8-6-12-7-9-13/h4-5,10,12H,1,6-9H2,2-3H3/b11-5+ |
| InChIKey | HGBNVXSSHHGMPD-VZUCSPMQSA-N |
| XLogP | 1.00 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine?
The IUPAC name of 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine (CID 142202943) is 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine.
What is the SMILES notation for 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine?
The canonical SMILES for 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine is C=C/C=C(/OC)C(C)N1CCNCC1.
What is the InChIKey of 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine?
The InChIKey is HGBNVXSSHHGMPD-VZUCSPMQSA-N. The full InChI is InChI=1S/C11H20N2O/c1-4-5-11(14-3)10(2)13-8-6-12-7-9-13/h4-5,10,12H,1,6-9H2,2-3H3/b11-5+.
What are the key properties of 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine?
1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine has a molecular weight of 196.29 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-3-methoxyhexa-3,5-dien-2-yl]piperazine is sourced from PubChem (CID 142202943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).