C11H21N3O — CID 142202965
(2E,4E)-2-methoxy-5-piperazin-1-ylhexa-2,4-dien-1-amine (PubChem CID 142202965) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,4E)-2-methoxy-5-piperazin-1-ylhexa-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-methoxy-5-piperazin-1-ylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142202965 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (2E,4E)-2-methoxy-5-piperazin-1-ylhexa-2,4-dien-1-amine |
| SMILES | CO/C(=C/C=C(\C)N1CCNCC1)CN |
| InChI | InChI=1S/C11H21N3O/c1-10(3-4-11(9-12)15-2)14-7-5-13-6-8-14/h3-4,13H,5-9,12H2,1-2H3/b10-3+,11-4+ |
| InChIKey | OVRSLZWRDTWXCM-HULALXFYSA-N |
| XLogP | 0.28 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|