C16H29N3O — CID 142099637
N'-ethyl-N'-methyl-N-[(1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-yl]ethane-1,2-diamine (PubChem CID 142099637) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-N-[(1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-yl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-methyl-N-[(1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 142099637 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | N'-ethyl-N'-methyl-N-[(1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-yl]ethane-1,2-diamine |
| SMILES | C/C=C\C(=C/C=C/N1CCOCC1)NCCN(C)CC |
| InChI | InChI=1S/C16H29N3O/c1-4-7-16(17-9-11-18(3)5-2)8-6-10-19-12-14-20-15-13-19/h4,6-8,10,17H,5,9,11-15H2,1-3H3/b7-4-,10-6+,16-8+ |
| InChIKey | LROWGRIMOAMXFY-MRBLXUNJSA-N |
| XLogP | 1.83 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|