C11H18N2O — CID 123992968
1-(5-methoxyhexa-1,3,5-trien-3-yl)piperazine (PubChem CID 123992968) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(5-methoxyhexa-1,3,5-trien-3-yl)piperazine.
| Compound Name | 1-(5-methoxyhexa-1,3,5-trien-3-yl)piperazine |
|---|---|
| PubChem CID | 123992968 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(5-methoxyhexa-1,3,5-trien-3-yl)piperazine |
| SMILES | C=CC(=CC(=C)OC)N1CCNCC1 |
| InChI | InChI=1S/C11H18N2O/c1-4-11(9-10(2)14-3)13-7-5-12-6-8-13/h4,9,12H,1-2,5-8H2,3H3 |
| InChIKey | VZXRLZQJGHVEPK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|