C11H15F3N2O — CID 145096196
1-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]piperazine (PubChem CID 145096196) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]piperazine.
| Compound Name | 1-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 145096196 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]piperazine |
| SMILES | C=C(/C=C\C(=C)N1CCNCC1)OC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O/c1-9(16-7-5-15-6-8-16)3-4-10(2)17-11(12,13)14/h3-4,15H,1-2,5-8H2/b4-3- |
| InChIKey | CCVZWEWJCBAFBM-ARJAWSKDSA-N |
| XLogP | 2.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|