C12H22N2O — CID 123502190
1-(1-methoxyhexa-2,4-dien-3-yl)-4-methylpiperazine (PubChem CID 123502190) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(1-methoxyhexa-2,4-dien-3-yl)-4-methylpiperazine.
| Compound Name | 1-(1-methoxyhexa-2,4-dien-3-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 123502190 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-(1-methoxyhexa-2,4-dien-3-yl)-4-methylpiperazine |
| SMILES | CC=CC(=CCOC)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H22N2O/c1-4-5-12(6-11-15-3)14-9-7-13(2)8-10-14/h4-6H,7-11H2,1-3H3 |
| InChIKey | RQUULXUVZAUDCU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|