C12H20N2O — CID 142128655
1-[(3E)-3-methoxyhexa-1,3,5-trien-2-yl]-4-methylpiperazine (PubChem CID 142128655) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[(3E)-3-methoxyhexa-1,3,5-trien-2-yl]-4-methylpiperazine.
| Compound Name | 1-[(3E)-3-methoxyhexa-1,3,5-trien-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142128655 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[(3E)-3-methoxyhexa-1,3,5-trien-2-yl]-4-methylpiperazine |
| SMILES | C=C/C=C(/OC)C(=C)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H20N2O/c1-5-6-12(15-4)11(2)14-9-7-13(3)8-10-14/h5-6H,1-2,7-10H2,3-4H3/b12-6+ |
| InChIKey | DTYBNNFIVBMJSI-WUXMJOGZSA-N |
| XLogP | 1.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|