C15H24N2O — CID 142099643
1-[(3Z)-5-(cyclopropylmethoxy)hexa-1,3,5-trien-2-yl]-4-methylpiperazine (PubChem CID 142099643) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(3Z)-5-(cyclopropylmethoxy)hexa-1,3,5-trien-2-yl]-4-methylpiperazine.
| Compound Name | 1-[(3Z)-5-(cyclopropylmethoxy)hexa-1,3,5-trien-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142099643 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-[(3Z)-5-(cyclopropylmethoxy)hexa-1,3,5-trien-2-yl]-4-methylpiperazine |
| SMILES | C=C(/C=C\C(=C)N1CCN(C)CC1)OCC1CC1 |
| InChI | InChI=1S/C15H24N2O/c1-13(17-10-8-16(3)9-11-17)4-5-14(2)18-12-15-6-7-15/h4-5,15H,1-2,6-12H2,3H3/b5-4- |
| InChIKey | MJTVECVUCHFNJJ-PLNGDYQASA-N |
| XLogP | 2.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|