C11H20N2O — CID 123324320
N'-(5-methoxyhexa-1,3,5-trien-2-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 123324320) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N'-(5-methoxyhexa-1,3,5-trien-2-yl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-(5-methoxyhexa-1,3,5-trien-2-yl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 123324320 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N'-(5-methoxyhexa-1,3,5-trien-2-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C(C=CC(=C)N(C)CCNC)OC |
| InChI | InChI=1S/C11H20N2O/c1-10(6-7-11(2)14-5)13(4)9-8-12-3/h6-7,12H,1-2,8-9H2,3-5H3 |
| InChIKey | WRQGJGWFCZRJGR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|