C12H17ClN2O — CID 143061464
1-(4-chloro-2-methoxycyclohepta-1,3,6-trien-1-yl)piperazine (PubChem CID 143061464) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxycyclohepta-1,3,6-trien-1-yl)piperazine.
| Compound Name | 1-(4-chloro-2-methoxycyclohepta-1,3,6-trien-1-yl)piperazine |
|---|---|
| PubChem CID | 143061464 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(4-chloro-2-methoxycyclohepta-1,3,6-trien-1-yl)piperazine |
| SMILES | COC1=C(N2CCNCC2)C=CCC(Cl)=C1 |
| InChI | InChI=1S/C12H17ClN2O/c1-16-12-9-10(13)3-2-4-11(12)15-7-5-14-6-8-15/h2,4,9,14H,3,5-8H2,1H3 |
| InChIKey | ISAHESQANCANJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |