C14H22Cl2N2O — CID 142099634
1-[(3E,5Z)-4,6-dichloro-5-methoxyocta-1,3,5-trien-2-yl]-4-methylpiperazine (PubChem CID 142099634) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is 1-[(3E,5Z)-4,6-dichloro-5-methoxyocta-1,3,5-trien-2-yl]-4-methylpiperazine.
| Compound Name | 1-[(3E,5Z)-4,6-dichloro-5-methoxyocta-1,3,5-trien-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142099634 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-[(3E,5Z)-4,6-dichloro-5-methoxyocta-1,3,5-trien-2-yl]-4-methylpiperazine |
| SMILES | C=C(/C=C(Cl)\C(OC)=C(\Cl)CC)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H22Cl2N2O/c1-5-12(15)14(19-4)13(16)10-11(2)18-8-6-17(3)7-9-18/h10H,2,5-9H2,1,3-4H3/b13-10+,14-12- |
| InChIKey | HPKHJPQMOZKXOO-QDLALYNESA-N |
| XLogP | 3.38 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|