C21H17ClFN3OS — CID 123497112
(4-chlorophenyl)-[2-(5-ethyl-1H-imidazol-2-yl)-5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanol (PubChem CID 123497112) has the molecular formula C21H17ClFN3OS and a molecular weight of 413.91 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(5-ethyl-1H-imidazol-2-yl)-5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanol.
| Compound Name | (4-chlorophenyl)-[2-(5-ethyl-1H-imidazol-2-yl)-5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanol |
|---|---|
| PubChem CID | 123497112 |
| Molecular Formula | C21H17ClFN3OS |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (4-chlorophenyl)-[2-(5-ethyl-1H-imidazol-2-yl)-5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanol |
| SMILES | CCc1cnc(-c2sc(-c3ccnc(F)c3)cc2C(O)c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C21H17ClFN3OS/c1-2-15-11-25-21(26-15)20-16(19(27)12-3-5-14(22)6-4-12)10-17(28-20)13-7-8-24-18(23)9-13/h3-11,19,27H,2H2,1H3,(H,25,26) |
| InChIKey | PFIJJTVNQGELPF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|