About 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate
1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate (PubChem CID 123497678) has the molecular formula C19H19N5O2
and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate.
Molecular Properties
| Compound Name | 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate |
| PubChem CID | 123497678 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate |
| SMILES | CC(OC=NN(C=CC=O)c1cnn(C)c1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H19N5O2/c1-15(16-6-7-19-17(11-16)5-3-8-20-19)26-14-22-24(9-4-10-25)18-12-21-23(2)13-18/h3-15H,1-2H3 |
| InChIKey | ZMJSJOLWAVSULR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate?
The IUPAC name of 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate (CID 123497678) is 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate.
What is the SMILES notation for 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate?
The canonical SMILES for 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate is CC(OC=NN(C=CC=O)c1cnn(C)c1)c1ccc2ncccc2c1.
What is the InChIKey of 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate?
The InChIKey is ZMJSJOLWAVSULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2/c1-15(16-6-7-19-17(11-16)5-3-8-20-19)26-14-22-24(9-4-10-25)18-12-21-23(2)13-18/h3-15H,1-2H3.
What are the key properties of 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate?
1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate has a molecular weight of 349.39 g/mol, XLogP of 3.21, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-quinolin-6-ylethyl N-(1-methylpyrazol-4-yl)-N-(3-oxoprop-1-enyl)methanehydrazonate is sourced from PubChem (CID 123497678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).