C22H29N2O4S+ — CID 123497833
diethyl-formyl-[[4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]azanium (PubChem CID 123497833) has the molecular formula C22H29N2O4S+ and a molecular weight of 417.55 g/mol. Its IUPAC name is diethyl-formyl-[[4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]azanium.
| Compound Name | diethyl-formyl-[[4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]azanium |
|---|---|
| PubChem CID | 123497833 |
| Molecular Formula | C22H29N2O4S+ |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | diethyl-formyl-[[4-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]azanium |
| SMILES | CC[N+](C=O)(CC)Cc1ccc2c(c1)CN(S(=O)(=O)c1ccc(C)cc1)CCO2 |
| InChI | InChI=1S/C22H29N2O4S/c1-4-24(5-2,17-25)16-19-8-11-22-20(14-19)15-23(12-13-28-22)29(26,27)21-9-6-18(3)7-10-21/h6-11,14,17H,4-5,12-13,15-16H2,1-3H3/q+1 |
| InChIKey | OBSKPELKNDTNCQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|