C14H25NO6 — CID 123498860
methyl 4,6-dihydroxy-3,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]hexanoate (PubChem CID 123498860) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 4,6-dihydroxy-3,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]hexanoate.
| Compound Name | methyl 4,6-dihydroxy-3,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]hexanoate |
|---|---|
| PubChem CID | 123498860 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | methyl 4,6-dihydroxy-3,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]hexanoate |
| SMILES | COC(=O)C(=NC(=O)OC(C)(C)C)C(C)C(O)C(C)CO |
| InChI | InChI=1S/C14H25NO6/c1-8(7-16)11(17)9(2)10(12(18)20-6)15-13(19)21-14(3,4)5/h8-9,11,16-17H,7H2,1-6H3 |
| InChIKey | MPCACIGXZXTLEN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|