C17H31NO5 — CID 123928800
methyl 7-hydroxy-3,4,5,6-tetramethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoate (PubChem CID 123928800) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl 7-hydroxy-3,4,5,6-tetramethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoate.
| Compound Name | methyl 7-hydroxy-3,4,5,6-tetramethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoate |
|---|---|
| PubChem CID | 123928800 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | methyl 7-hydroxy-3,4,5,6-tetramethyl-2-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoate |
| SMILES | COC(=O)C(=NC(=O)OC(C)(C)C)C(C)C(C)C(C)C(C)CO |
| InChI | InChI=1S/C17H31NO5/c1-10(9-19)11(2)12(3)13(4)14(15(20)22-8)18-16(21)23-17(5,6)7/h10-13,19H,9H2,1-8H3 |
| InChIKey | USYDASCXNPEINU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|