C12H19NO4 — CID 144740521
4-[(2-methylpropan-2-yl)oxycarbonylimino]cyclohexane-1-carboxylic acid (PubChem CID 144740521) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylimino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylimino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 144740521 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylimino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N=C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H19NO4/c1-12(2,3)17-11(16)13-9-6-4-8(5-7-9)10(14)15/h8H,4-7H2,1-3H3,(H,14,15)/b13-9- |
| InChIKey | LLOHPIZSWOCLHF-LCYFTJDESA-N |
| XLogP | 2.64 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|