C19H35NO5 — CID 145485147
tert-butyl (NZ)-N-[(3S,8S)-3,8-bis(hydroxymethyl)-2,9-dimethyl-6-oxodecan-5-ylidene]carbamate (PubChem CID 145485147) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(3S,8S)-3,8-bis(hydroxymethyl)-2,9-dimethyl-6-oxodecan-5-ylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(3S,8S)-3,8-bis(hydroxymethyl)-2,9-dimethyl-6-oxodecan-5-ylidene]carbamate |
|---|---|
| PubChem CID | 145485147 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | tert-butyl (NZ)-N-[(3S,8S)-3,8-bis(hydroxymethyl)-2,9-dimethyl-6-oxodecan-5-ylidene]carbamate |
| SMILES | CC(C)C(CO)CC(=O)/C(C[C@H](CO)C(C)C)=N\C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35NO5/c1-12(2)14(10-21)8-16(20-18(24)25-19(5,6)7)17(23)9-15(11-22)13(3)4/h12-15,21-22H,8-11H2,1-7H3/b20-16-/t14-,15?/m1/s1 |
| InChIKey | UKEHFARXBVOZAH-PQDCOZNUSA-N |
| XLogP | 3.24 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|