C20H30N2O3S — CID 123500008
8-cyclopropylsulfonyl-2-(4-propan-2-yloxyphenyl)-2,8-diazaspiro[4.5]decane (PubChem CID 123500008) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 8-cyclopropylsulfonyl-2-(4-propan-2-yloxyphenyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-cyclopropylsulfonyl-2-(4-propan-2-yloxyphenyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 123500008 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 8-cyclopropylsulfonyl-2-(4-propan-2-yloxyphenyl)-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)Oc1ccc(N2CCC3(CCN(S(=O)(=O)C4CC4)CC3)C2)cc1 |
| InChI | InChI=1S/C20H30N2O3S/c1-16(2)25-18-5-3-17(4-6-18)21-12-9-20(15-21)10-13-22(14-11-20)26(23,24)19-7-8-19/h3-6,16,19H,7-15H2,1-2H3 |
| InChIKey | MYTRPBUCYLZPNT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|