C25H31ClN2O3S — CID 66787394
8-(2-chlorophenyl)sulfonyl-2-(4-cyclopentyloxyphenyl)-2,8-diazaspiro[4.5]decane (PubChem CID 66787394) has the molecular formula C25H31ClN2O3S and a molecular weight of 475.05 g/mol. Its IUPAC name is 8-(2-chlorophenyl)sulfonyl-2-(4-cyclopentyloxyphenyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-(2-chlorophenyl)sulfonyl-2-(4-cyclopentyloxyphenyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 66787394 |
| Molecular Formula | C25H31ClN2O3S |
| Molecular Weight | 475.05 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 8-(2-chlorophenyl)sulfonyl-2-(4-cyclopentyloxyphenyl)-2,8-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCC2(CCN(c3ccc(OC4CCCC4)cc3)C2)CC1 |
| InChI | InChI=1S/C25H31ClN2O3S/c26-23-7-3-4-8-24(23)32(29,30)28-17-14-25(15-18-28)13-16-27(19-25)20-9-11-22(12-10-20)31-21-5-1-2-6-21/h3-4,7-12,21H,1-2,5-6,13-19H2 |
| InChIKey | NANJRKFINDKLKF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.05 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|