C14H18ClNO4S — CID 3766966
9-(2-chlorophenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 3766966) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is 9-(2-chlorophenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-(2-chlorophenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 3766966 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 9-(2-chlorophenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCC2(CC1)OCCCO2 |
| InChI | InChI=1S/C14H18ClNO4S/c15-12-4-1-2-5-13(12)21(17,18)16-8-6-14(7-9-16)19-10-3-11-20-14/h1-2,4-5H,3,6-11H2 |
| InChIKey | YNWJEDWKLLDKBM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |