C24H26F4N2O2S — CID 123565629
2-(4-cyclopropylphenyl)-8-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane (PubChem CID 123565629) has the molecular formula C24H26F4N2O2S and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-(4-cyclopropylphenyl)-8-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-(4-cyclopropylphenyl)-8-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 123565629 |
| Molecular Formula | C24H26F4N2O2S |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-(4-cyclopropylphenyl)-8-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccc(F)cc1C(F)(F)F)N1CCC2(CCN(c3ccc(C4CC4)cc3)C2)CC1 |
| InChI | InChI=1S/C24H26F4N2O2S/c25-19-5-8-22(21(15-19)24(26,27)28)33(31,32)30-13-10-23(11-14-30)9-12-29(16-23)20-6-3-18(4-7-20)17-1-2-17/h3-8,15,17H,1-2,9-14,16H2 |
| InChIKey | SIJOCBIPFIZNFC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|