C49H86O5 — CID 123500549
2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-hydroxy-3-octadec-9-enoxybutanoic acid (PubChem CID 123500549) has the molecular formula C49H86O5 and a molecular weight of 755.22 g/mol. Its IUPAC name is 2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-hydroxy-3-octadec-9-enoxybutanoic acid.
| Compound Name | 2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-hydroxy-3-octadec-9-enoxybutanoic acid |
|---|---|
| PubChem CID | 123500549 |
| Molecular Formula | C49H86O5 |
| Molecular Weight | 755.22 g/mol |
| Exact Mass | 754.65 |
| IUPAC Name | 2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-hydroxy-3-octadec-9-enoxybutanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(CO)C(OC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1)C(=O)O |
| InChI | InChI=1S/C49H86O5/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-34-53-45(36-50)46(47(51)52)54-40-30-32-48(5)39(35-40)26-27-41-43-29-28-42(38(4)25-23-24-37(2)3)49(43,6)33-31-44(41)48/h14-15,26,37-38,40-46,50H,7-13,16-25,27-36H2,1-6H3,(H,51,52)/t38-,40?,41?,42-,43?,44?,45?,46?,48+,49-/m1/s1 |
| InChIKey | FHBIZIXQNMWILQ-ODPYSVBNSA-N |
| XLogP | 13.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.22 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|