C32H54O3 — CID 175026862
2-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentanoic acid (PubChem CID 175026862) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is 2-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentanoic acid.
| Compound Name | 2-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 175026862 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | 2-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]pentanoic acid |
| SMILES | CCCC(O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1)C(=O)O |
| InChI | InChI=1S/C32H54O3/c1-7-9-29(30(33)34)35-24-16-18-31(5)23(20-24)12-13-25-27-15-14-26(22(4)11-8-10-21(2)3)32(27,6)19-17-28(25)31/h12,21-22,24-29H,7-11,13-20H2,1-6H3,(H,33,34)/t22-,24+,25+,26-,27+,28+,29?,31+,32-/m1/s1 |
| InChIKey | JPSQTMFUXPHLAR-VYGNMKMISA-N |
| XLogP | 8.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|