C18H22FN3O3 — CID 123500847
[3-[(2R)-2-[3-fluoro-5-(2-methoxyethoxy)phenyl]pyrrolidin-1-yl]-2H-pyran-6-yl]diazene (PubChem CID 123500847) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is [3-[(2R)-2-[3-fluoro-5-(2-methoxyethoxy)phenyl]pyrrolidin-1-yl]-2H-pyran-6-yl]diazene.
| Compound Name | [3-[(2R)-2-[3-fluoro-5-(2-methoxyethoxy)phenyl]pyrrolidin-1-yl]-2H-pyran-6-yl]diazene |
|---|---|
| PubChem CID | 123500847 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [3-[(2R)-2-[3-fluoro-5-(2-methoxyethoxy)phenyl]pyrrolidin-1-yl]-2H-pyran-6-yl]diazene |
| SMILES | [H]/N=N/C1=CC=C(N2CCC[C@@H]2c2cc(F)cc(OCCOC)c2)CO1 |
| InChI | InChI=1S/C18H22FN3O3/c1-23-7-8-24-16-10-13(9-14(19)11-16)17-3-2-6-22(17)15-4-5-18(21-20)25-12-15/h4-5,9-11,17,20H,2-3,6-8,12H2,1H3/b21-20+/t17-/m1/s1 |
| InChIKey | GRECFZNGCZETDL-SGRLSNSRSA-N |
| XLogP | 3.77 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|