C27H33N3O6 — CID 123502778
N-[1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-4-butoxy-3-methoxybenzamide;carbon dioxide (PubChem CID 123502778) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-4-butoxy-3-methoxybenzamide;carbon dioxide.
| Compound Name | N-[1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-4-butoxy-3-methoxybenzamide;carbon dioxide |
|---|---|
| PubChem CID | 123502778 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-[1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-4-butoxy-3-methoxybenzamide;carbon dioxide |
| SMILES | CCCCOc1ccc(C(=O)NC(CC)COc2cccc3nc(C)cc(N)c23)cc1OC.O=C=O |
| InChI | InChI=1S/C26H33N3O4.CO2/c1-5-7-13-32-22-12-11-18(15-24(22)31-4)26(30)29-19(6-2)16-33-23-10-8-9-21-25(23)20(27)14-17(3)28-21;2-1-3/h8-12,14-15,19H,5-7,13,16H2,1-4H3,(H2,27,28)(H,29,30); |
| InChIKey | KWOGPZNOTVKBTB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|