C21H23N3O3 — CID 58460428
N-[(2S)-1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-3-hydroxybenzamide (PubChem CID 58460428) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(2S)-1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-3-hydroxybenzamide.
| Compound Name | N-[(2S)-1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 58460428 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[(2S)-1-(4-amino-2-methylquinolin-5-yl)oxybutan-2-yl]-3-hydroxybenzamide |
| SMILES | CC[C@@H](COc1cccc2nc(C)cc(N)c12)NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-3-15(24-21(26)14-6-4-7-16(25)11-14)12-27-19-9-5-8-18-20(19)17(22)10-13(2)23-18/h4-11,15,25H,3,12H2,1-2H3,(H2,22,23)(H,24,26)/t15-/m0/s1 |
| InChIKey | FICMEQDBKQANLW-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |