C21H21N3O5 — CID 54588550
4-amino-5-[2-[(3-hydroxybenzoyl)amino]propoxy]-2-methylquinoline-3-carboxylic acid (PubChem CID 54588550) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-amino-5-[2-[(3-hydroxybenzoyl)amino]propoxy]-2-methylquinoline-3-carboxylic acid.
| Compound Name | 4-amino-5-[2-[(3-hydroxybenzoyl)amino]propoxy]-2-methylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54588550 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-amino-5-[2-[(3-hydroxybenzoyl)amino]propoxy]-2-methylquinoline-3-carboxylic acid |
| SMILES | Cc1nc2cccc(OCC(C)NC(=O)c3cccc(O)c3)c2c(N)c1C(=O)O |
| InChI | InChI=1S/C21H21N3O5/c1-11(23-20(26)13-5-3-6-14(25)9-13)10-29-16-8-4-7-15-18(16)19(22)17(21(27)28)12(2)24-15/h3-9,11,25H,10H2,1-2H3,(H2,22,24)(H,23,26)(H,27,28) |
| InChIKey | XUCJOOQXQNMFHY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |