C24H27N3O7 — CID 139421887
4-amino-5-[2-[[3-hydroxy-4-(3-hydroxypropoxy)benzoyl]amino]propoxy]-2-methylquinoline-3-carboxylic acid (PubChem CID 139421887) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is 4-amino-5-[2-[[3-hydroxy-4-(3-hydroxypropoxy)benzoyl]amino]propoxy]-2-methylquinoline-3-carboxylic acid.
| Compound Name | 4-amino-5-[2-[[3-hydroxy-4-(3-hydroxypropoxy)benzoyl]amino]propoxy]-2-methylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139421887 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-amino-5-[2-[[3-hydroxy-4-(3-hydroxypropoxy)benzoyl]amino]propoxy]-2-methylquinoline-3-carboxylic acid |
| SMILES | Cc1nc2cccc(OCC(C)NC(=O)c3ccc(OCCCO)c(O)c3)c2c(N)c1C(=O)O |
| InChI | InChI=1S/C24H27N3O7/c1-13(26-23(30)15-7-8-18(17(29)11-15)33-10-4-9-28)12-34-19-6-3-5-16-21(19)22(25)20(24(31)32)14(2)27-16/h3,5-8,11,13,28-29H,4,9-10,12H2,1-2H3,(H2,25,27)(H,26,30)(H,31,32) |
| InChIKey | XPRRYBQNEMHBFR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|