C23H25F2N5 — CID 123503153
1-[6-[5-(2,4-difluorohexa-2,4-dien-3-yl)-1H-indol-3-yl]pyrazin-2-yl]piperidin-4-amine (PubChem CID 123503153) has the molecular formula C23H25F2N5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-[6-[5-(2,4-difluorohexa-2,4-dien-3-yl)-1H-indol-3-yl]pyrazin-2-yl]piperidin-4-amine.
| Compound Name | 1-[6-[5-(2,4-difluorohexa-2,4-dien-3-yl)-1H-indol-3-yl]pyrazin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 123503153 |
| Molecular Formula | C23H25F2N5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[6-[5-(2,4-difluorohexa-2,4-dien-3-yl)-1H-indol-3-yl]pyrazin-2-yl]piperidin-4-amine |
| SMILES | CC=C(F)C(=C(C)F)c1ccc2[nH]cc(-c3cncc(N4CCC(N)CC4)n3)c2c1 |
| InChI | InChI=1S/C23H25F2N5/c1-3-19(25)23(14(2)24)15-4-5-20-17(10-15)18(11-28-20)21-12-27-13-22(29-21)30-8-6-16(26)7-9-30/h3-5,10-13,16,28H,6-9,26H2,1-2H3 |
| InChIKey | QZQDVJZKAYPSTR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|