About 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid
4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid (PubChem CID 123503641) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid |
| PubChem CID | 123503641 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid |
| SMILES | C=CC1C=CC=C(CCCC(=O)O)C=C1 |
| InChI | InChI=1S/C13H16O2/c1-2-11-5-3-6-12(10-9-11)7-4-8-13(14)15/h2-3,5-6,9-11H,1,4,7-8H2,(H,14,15) |
| InChIKey | LGJPYSMODBDAFQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid?
The IUPAC name of 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid (CID 123503641) is 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid.
What is the SMILES notation for 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid?
The canonical SMILES for 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid is C=CC1C=CC=C(CCCC(=O)O)C=C1.
What is the InChIKey of 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid?
The InChIKey is LGJPYSMODBDAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-11-5-3-6-12(10-9-11)7-4-8-13(14)15/h2-3,5-6,9-11H,1,4,7-8H2,(H,14,15).
What are the key properties of 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid?
4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid has a molecular weight of 204.27 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethenylcyclohepta-1,3,6-trien-1-yl)butanoic acid is sourced from PubChem (CID 123503641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).