C15H21Cl2NO2 — CID 143136176
4-[4-[bis(2-chloroethyl)amino]cyclohepta-1,3,6-trien-1-yl]butanoic acid (PubChem CID 143136176) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-[4-[bis(2-chloroethyl)amino]cyclohepta-1,3,6-trien-1-yl]butanoic acid.
| Compound Name | 4-[4-[bis(2-chloroethyl)amino]cyclohepta-1,3,6-trien-1-yl]butanoic acid |
|---|---|
| PubChem CID | 143136176 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[4-[bis(2-chloroethyl)amino]cyclohepta-1,3,6-trien-1-yl]butanoic acid |
| SMILES | O=C(O)CCCC1=CC=C(N(CCCl)CCCl)CC=C1 |
| InChI | InChI=1S/C15H21Cl2NO2/c16-9-11-18(12-10-17)14-5-1-3-13(7-8-14)4-2-6-15(19)20/h1,3,7-8H,2,4-6,9-12H2,(H,19,20) |
| InChIKey | WQZQEKHSNVBBBU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|